|
|
Proveedores de
3-(Perfluoro-7-methyloctyl)-1,2-propenoxide
|
Identificación | CAS |
41925-33-1 | Formula |
C12H5F19O | EINECS |
255-587-8 |
|
|
4 Proveedores registrados
Molecular Formula: C12H5F19O Molecular Weight: 526.14 Hazard Symbols: Xi WGKGermany: 3
Description: The chemical compound, 3-(Perfluoro-7-methyloctyl)-1,2-propenoxide, a commonly utilized reagent in research within the pharmaceutical industry, harbors potential for application in the synthesis of specific pharmaceuticals. Additionally, the compound's mechanisms may be studied for the purpose of investigating underlying causes of certain ailments. - Molecular Weight:526.14
- Boiling Point:93-94ºC8 mm Hg(lit.)
- Purity:95%
Molecular Formula: C12H5F19O Canonical SMILES: C1C(O1)CC(C(C(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F InChI: InChI=1S/C12H5F19O/c13-4(14,1-3-2-32-3)6(16,17)8(20,21)10(24,25)9(22,23)7(18,19)5(15,11(26,27)28)12(29,30)31/h3H,1-2H2 InChIKey: ZFJPGQQBBNLQOX-UHFFFAOYSA-N Synonyms: (2,2,3,3,4,4,5,5,6,6,7,7,8,9,9,9-Hexadecafluoro-8-(trifluoromethyl)nonyl)oxirane Más detalles se encuentran aquí
|
|
|
Proveedores privilegiados
Última actualización 2024-06-21 |