|
|
|
|
Lieferanten für
Fenofibrate
|
Daten | | CAS |
49562-28-9 | | Formula |
C20H21ClO4 | | EINECS |
256-376-3 |
|
|
29 Registerierte Lieferanten
| Character | A white or almost white,crystalline powder, practically insoluble in water , very soluble in methylene chloride, slightly soluble in alcohol
| | Identification | Should comply with the IR spectrum
| | Melting point | 79℃ ~82℃
| | Appearance of solution | Clear and not more colored than BY6
| | Acidity | ≤ 0.2 ml
| | Related substances |
| | Impurity A | ≤ 0.1%
| | Impurity B | ≤ 0.1%
| | Impurity G | ≤ 0.2%
| | Any other impurity | ≤ 0.10%
| | Total impurities | ≤ 0.5%
| | Halides expressed as chlorides | ≤ 100 ppm
| | Sulphates | ≤ 100 ppm
| | Heavy metals | ≤ 20 ppm
| | Loss on drying | ≤ 0.5%
| | Sulphated ash | ≤ 0.1%
| | Assay On dried basis | 98.0%~101.0%
| | Residual solvents |
| | Acetone | ≤ 5000 ppm
| | Isopropyl alcohol | ≤ 5000 ppm
| | Toluene | ≤ 890 ppm
| | Butyl acetate | ≤ 5000 ppm
| | Standard | BP and EP standard
| | Content | 98.0%~101.0%
| | Capacity | 50MT/month
| | Loading port | Shanghai
| | Package | 1kg/bag,25kg/drum or according to the customers’ demand
| | Storage | Stored in the dry and ventilated inside storeroom, prevent direct sunlight, slightly pile and put down |
Weitere Informationen finden Sie hier
Molecular Formula: C20H21ClO4 Molecular Weight: 360,84 Weitere Informationen finden Sie hier
Purity: 97% Smile code: CC(C)(OC1=CC=C(C(C2=CC=C(Cl)C=C2)=O)C=C1)C(OC(C)C)=O MDL Number: MFCD00133314 MolFormula: C20H21ClO4 MolWeight: 360.8314 Available in stock: 12275.258 Weitere Informationen finden Sie hier
|
|
|
Privilegierte Lieferanten
Letztes Update 2024-05-10
|
_Co_Ltd_1_575.jpg){kind=logo}
details
details