|
|
Lieferanten für
2,4,6-Trichloro-N-phenylaniline
|
|
1 Registerierte Lieferanten
Description: A Diclofenac impurity which is a non-selective COX inhibitor with IC50 of 60 and 220 nM for ovine COX-1 and -2, respectively. Molecular Formula: C12H8Cl3N Canonical SMILES: C1=CC=C(C=C1)NC2=C(C=C(C=C2Cl)Cl)Cl InChI: InChI=1S/C12H8Cl3N/c13-8-6-10(14)12(11(15)7-8)16-9-4-2-1-3-5-9/h1-7,16H InChIKey: HLNRCXQIZGIJSU-UHFFFAOYSA-N Synonyms: 2,4,6-Trichlorodiphenylamine; Diphenylamine, 2,4,6-trichloro; Diclofenac Impurity 10 Weitere Informationen finden Sie hier
|
|
|
Privilegierte Lieferanten
Letztes Update 2024-06-18
|