|
|
Proveedores de
2-(N-Morpholino)ethanesulfonic acid
|
Identificación | CAS |
4432-31-9 | Formula |
C6H13NO4S | EINECS |
224-632-3 |
|
|
12 Proveedores registrados
Molecular Formula: C6H13NO4S
Smile code:OS(=O)(=O)CCN1CCOCC1 MDL Number:MFCD00006181 Purity :98% Available in stock: 67769.5 g Más detalles se encuentran aquí
Product Name: 4-Morpholineethanesulfonic acid MF: C6H13NO4S MW: 195.24 EINECS: 224-632-3 4-Morpholineethanesulfonic acid Chemical Properties mp >300 °C(lit.) storage temp. Store at RT. solubility H2O: 0.5 M at 20 °C, clear Merck 13,5929 Stability: Stable. Incompatible with strong oxidizing agents. Molecular Formula: C6H13NO4S Molecular weight (Molecular Wt): 195.2 Appearance: Pure white powder Water-soluble: clear, transparent Content ≥ 99% Package: 25KG / barrel
Application: In biological experiments, it is an important PH stabilizing agent, usually select the appropriate weak acid and its conjugate base to get the appropriate PH value. Most biological reactions occur under neutral conditions, typically between pH 6 and pH 8, and require buffers to have effective buffer ranges between 6-8. another The acid-base form of the buffers is not required to chelate with certain metal ions. Biological Buffer Features: 1. highly water-soluble 2. compatible acid-base dissociation balance 3. low cell membrane permeability 4. low metal chelating ability 5. high chemical stability 6. in the UV - visible light area has a lower absorption
|
|
|
Proveedores privilegiados
Última actualización 2024-05-24 |