|
|
|
|
Lieferanten für
2-(Dimethylamino)ethyl benzoate
|
Daten | | CAS |
2208-05-1 | | Formula |
C11H15NO2 | | EINECS |
218-630-1 |
|
|
12 Registerierte Lieferanten
Molecular Formula: C11H15NO2
| Appearance | Colorless to pale yellow liquid
| | Purity | 99% Min
| | Density | 1.014
| | B.P. | 155-159 ºC (20 mmHg)
| | Refractive index | 1.5077
| | F.P. | >110 ºC
| | Absorption Peak | 310nm
| | Usage | DMB is a highly efficient amine synergist (aminobenzoate)which is used in combination with Type II photoinitiators to initiateradical photopolymerisation of unsaturated resins such as those based on a prepolymer - e.g. acrylates - in combination with mono- ormultifunctional monomers as reactive thinners |
Molecular Formula: C11H15NO2 Molecular Weight: 193.24 Hazard Symbols: Xi WGKGermany: 3
Weitere Informationen finden Sie hier
Smile code:O=C(OCCN(C)C)C1=CC=CC=C1 MDL Number:MFCD00051067 Purity :97% Available in stock: 355 g Weitere Informationen finden Sie hier
|
|
|
Privilegierte Lieferanten
Letztes Update 2024-06-12
|
details
details
details