|
|
|
|
Proveedores de
Nevirapine
|
Identificación | | CAS |
129618-40-2 | | Formula |
C15H14N4O |
|
|
13 Proveedores registrados
| Appearance | White crystalline powder
| | Identification | IR HPLC
| | Water | ≤ 0.2%
| | Residue on ignition | ≤ 0.1%
| | Heavy metals | ≤ 0.001%
| | Residual solvents |
| | Ethanol | ≤ 5000ppm
| | Ethyl acetate | ≤ 5000ppm
| | Diglyme | ≤ 50ppm
| | Related substances |
| | Nevirapine related compound A | ≤ 0.2%
| | Nevirapine related compound B | ≤ 0.2%
| | Nevirapine impurity C | ≤ 0.2%
| | Individual impurity | ≤ 0.1%
| | Total impurities | ≤ 0.6%
| | Assay | 98.0%-102.0%（ anhydrous and solvent-free）
| | Packing and storage | Preserve in tight container, stored at 25℃ , excursions permitted
| | between | 15℃ ~ 30℃ |
Molecular Formula: C15H14N4O Molecular Weight: 266,3 Más detalles se encuentran aquí
Purity: 98% Smile code: O=C1C2=CC=CN=C2N(C3CC3)C4=NC=CC(C)=C4N1 MDL Number: MFCD00866928 MolFormula: C15H14N4O MolWeight: 266.2979 Available in stock: 1210.076 Más detalles se encuentran aquí
Más detalles se encuentran aquí
|
|
|
Proveedores
privilegiados
Última actualización
2024-06-03 |
details
details