|
|
Lieferanten für
Adenosine 5'-monophosphate
|
Daten | CAS |
61-19-8 | Formula |
C10H14N5O7P | EINECS |
200-500-0 |
|
|
30 Registerierte Lieferanten
Appearance | White powder
| Identification(HPLC) | Conforms to the RT of standard
| Identification(UV) |
| UV(A250/260) | 0.82~0.86
| UV(A280/260) | 0.20~0.24
| Transmittance | ≥ 97.0%
| Loss on drying | ≤ 6.0%
| Heavy metals | ≤ 10ppm
| PH | 2.5~3.5
| Arsenic | ≤ 2ppm
| Iron | ≤ 20ppm
| Total impurities(HPLC) | ≤ 2.0%
| Purity(HPLC) | ≥ 98.0%
| Assay(HPLC) | ≥ 98.0%
| Assay(UV) | ≥ 98.0% |
Molecular Formula: C10H14N5O7P Molecular Weight: 347.22 WGKGermany: 3 HS Code: 29389090
Weitere Informationen finden Sie hier
Weitere Informationen finden Sie hier
Purity: 97% Smile code: O[C@@H]([C@H]([C@H](N1C=NC2=C1N=CN=C2N)O3)O)[C@H]3COP(O)(O)=O MDL Number: MFCD00005750 MolFormula: C10H14N5O7P MolWeight: 347.2200 Available in stock: 7472.5 Weitere Informationen finden Sie hier
Mp | 178-185 °C
| storage temp. | − 20°C
| solubility H2O | with addition of mild alkalisoluble |
|
|
|
Privilegierte Lieferanten
Letztes Update 2024-05-27
|