|
|
|
|
Lieferanten für
2-Chloro-4-amino-6,7-dimethoxyquinazoline
|
Daten | | CAS |
23680-84-4 | | Formula |
C10H10ClN3O2 | | EINECS |
245-821-7 |
|
|
19 Registerierte Lieferanten
Molecular Formula: C10H10ClN3O2
| Appearance | White or off-white flocculent crystallization
| | Identification | HPLC
| | Assay HPLC | ≥ 99.5%
| | Moisture | ≤ 0.5%
| | Residue on ignition | ≤ 0.1%
| | Related substances |
| | Total impurity | ≤ 0.5%
| | 2,4-dihydroxy-6,7-dimethoxyquinazoline | ≤ 0.1%
| | 2,4-dichlorin-6,7-dimethoxyquinazoline | ≤ 0.1%
| | Single impurity | ≤ 0.1%
| | Standard | Technical grade
| | Content | 99.5%
| | Capacity | 50MT/month
| | Use | 2-Chloro-4-amino-6,7-dimethoxyquinazoline is well used pharmaceutical intermediate for Quinapril
| | Package | 25kg/drum or according to the customers’ demand
| | Storage | Stored in the dry and ventilated inside storeroom, prevent direct sunlight, slightly pile and put down |
Molecular Formula: C10H10ClN3O2 Molecular Weight: 239.66 Hazard Symbols: Xi,Xn WGKGermany: 3 HS Code: 29339900
Weitere Informationen finden Sie hier
EINECS:245-821-7
Molecular formula:C10H10ClN3O2
Smile code:NC1=C2C=C(OC)C(OC)=CC2=NC(Cl)=N1 MDL Number:MFCD00051734 Purity :98% Available in stock: 1685 g Weitere Informationen finden Sie hier
|
|
|
Privilegierte Lieferanten
Letztes Update 2024-06-14
|
details
details
details