|
|
Proveedores de
Prasugrel acetyl impurity
|
Identificación | CAS |
1443034-67-0 |
|
2 Proveedores registrados
Molecular Formula: C18H18FNO3S Molecular Weight: 347.4038232
Description: An impurity of Prasugrel.Prasugrel is a platelet inhibitor. It can be used to prevent formation of blood clots - Molecular Weight:347.41
- Purity:> 95%
Molecular Formula: C18H18FNO3S Canonical SMILES: CC(=O)C(C1=CC=CC=C1F)N2CCC3=C(C2)C=C(S3)OC(=O)C Synonyms: 5-(1-(2-Fluorophenyl)-2-oxopropyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)acetate; Más detalles se encuentran aquí
|
|
|
Proveedores privilegiados
Última actualización 2024-05-31 |