|
|
|
BLD Pharmatech Ltdis a supplier of
|
 |
Nickel(II) bromide ethylene glycol dimethyl ether complex |
|
|
This listing includes other chemicals and chemical products supplied by BLD Pharmatech Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on BLD Pharmatech Ltd |
Founded in 2014 and headquartered in Shanghai, China, BLD Pharmatech Ltd. with more than 600,000 items, scale up manufacture and custom services is a leading manufacturer and supplier of diversified research chemicals in the industry. Our considerable stock of a wide range of laboratory chemicals, from heterocycles, boron acids, amino acids, metal catalysts to chiral compounds, is ready for worldwide shipping.
The ISO certifications and DUNS registration are our testimonies as a trusted international partner. What’s more, the inventory data in China, India, the U.S. and Germany are globally synchronized. Generally, the global storage and delivery network can help to realize same-day and over-night deliveries for local stock products.
One-stop services from R&D, sales to post-sales support with offices worldwide enable us to provide first-rate service which earns us a good reputation in the industry.
We believe that high quality, cost-saving price, and fast delivery are the key features drove you choose us as a long-term partner.
|
|
BLD Pharmatech Ltd also offers: Nickel(II) bromide 3-hydrate Nickel(II) bromide 2-methoxyethyl ether complex Nickel(II) bromide Nickel(II) acetylacetonate Nickel(Ⅱ) acetate 4-hydrate Nickel iodide (NiI2) Nickel dibutyldithiocarbamate Nickel bis(trifluoromethylsulfonyl)imide Nickel acetylacetonate hydrate Ni(tbustb)3 NHS-PEO4-Biotin Neopentylboronic acid Neopentyl glycol diglycidyl ether Neodecanoic acid Naphtho[2,3-c]furan-1,3-dione Naphthalene-2-sulfonyl chloride Naphthalene-2-sulfonic acid hydrate Naphthalene-2-sulfonic acid Naphthalene-2,7-dicarboxylic acid Naphthalene-2,6-dicarbonyl dichloride Naphthalene-2,6-diamine Naphthalene-1-boronic acid Naphthalene-1,8-diol Naphthalene-1,8-diamine Naphthalene-1,5-diol Naphthalene-1,4-dicarboxylic acid Naphthalene-1,3-diol Naphthalene-1,2-diamine dihydrochloride Naphthalene 1,4-dicarboxaldehyde Naphthalen-2-ylmethylamine hydrochloride Naphthalen-1-ylmethanol Naphthalen-1-ylmethanamine Naphthalen-1-yl acetate Nalpha-Acetyl-L-lysine N6-benzoyladenosine N5-acetyl-N2-Fmoc-L-ornithine N5-(6-aminohexyl)-N7-benzyl-3-isopropylpyrazolo[1,5-a]pyrimidine-5,7-diamine hydrochloride N5-((R)-3-(acetylthio)-1-((carboxymethyl)amino)-1-oxopropan-2-yl)-L-glutamine N4-Benzoylcytidine N4-Acetylcytidine N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine bis(phosphate) N4-(7-Chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine N4-(6-Methoxyquinolin-8-yl)pentane-1,4-diamine phosphate N4-(6-chloro-2-methoxyacridin-9-yl)-N1,N1-diethylpentane-1,4-diamine dihydrochloride N4-(4-phenoxyphenethyl)quinazoline-4,6-diamine N4-(3-Ethynylphenyl)-7-methoxyquinazoline-4,6-diamine N4-(3-Chloro-4-fluorophenyl)-7-methoxyquinazoline-4,6-diamine N4-(3-aMinophenyl)-5-fluoro-N2-(4-(2-Methoxyethoxy)phenyl)pyriMidine-2,4-diaMine N4-(1-(4-cyanobenzyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl)-7-fluoroquinoline-2,4-dicarboxamide N4,N4,N4',N4'-tetrakis([1,1'-biphenyl]-4-yl)-[1,1'-biphenyl]-4,4'-diamine
|
|
|
| Nickel(II) bromide ethylene glycol dimethyl ether complex is offered by other companies |
Amadis Chemical Company Limited
|
Ambeed, Inc.
|
Leap Chem Co., Ltd
|
|
|
|
|
|