|
|
|
Dayang Chem (Hangzhou) Co.,Ltd.is a supplier of
|
_Co_Ltd_1_575.jpg "Dayang Chem (Hangzhou) Co.,Ltd.") |
bis-(4-tert-Butylphenyl)amine |
|
|
This listing includes other chemicals and chemical products supplied by Dayang Chem (Hangzhou) Co.,Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Dayang Chem (Hangzhou) Co.,Ltd. |
Dayang Chem (Hangzhou) Co.,Ltd. is a comprehensive entity which specializes in development, production and trade of pharmaceutical, agrochemical and dyestuff intermediates as well as some special type reagents. We have an own factory and share enterprises. We act also as agent of many chemical factories and promote their products to the international market at very competitive price.
We take "Credi first, Clients supreme" as our aim. We expect to cooperate with more partners in the world by providing superior quality chemicals and best service.
|
|
Dayang Chem (Hangzhou) Co.,Ltd. also offers: bis-(4-tert-Butylphenyl)-iodonium hexafluoroantimonate bis-(4-tert-Butylcyclohexyl)peroxydicarbonate bis-(4-tert-Butyl-phenyl)-methanone bis-(4-Pyridylmethyl) disulfide bis-(4-Nonylphenyl) tridecyl phosphite bis-(4-Nitrophenyl)phosphoro chloridate bis-(4-Nitrophenyl)phosphate hydrate bis-(4-Nitrophenyl)amine bis-(4-Nitrophenyl)-2-nitrophenylamine bis-(4-Nitrophenyl) sulfide bis-(4-Nitrophenyl) disulfide bis-(4-Nitrobenzoyl)diazene bis-(4-N,N-Diethylamino-2-methylphenyl)-4-methylphenylmethane bis-(4-Methylphenyl)phosphinous chloride bis-(4-Methylphenyl)iodonium hexafluorophosphate bis-(4-Methylphenyl)chlorophosphine bis-(4-Methyloctyl) phthalate bis-(4-Methylcyclohexyl) adipate bis-(4-Methyl-2-pentyl)phthalate bis-(4-Methyl-1-piperazinylthiocarbonyl)disulfide bis-(4-Methoxyphenyl)dimethylsilane bis-(4-Methoxyphenyl)carbonate bis-(4-Methoxyphenyl)(4-nitrophenyl)phenylphosphonium bromide bis-(4-Methoxybenzoyl)diethylgermanium bis-(4-Methoxy-2-nitrophenyl)diselenide bis-(4-Methacryloylthiophenyl) sulfide bis-(4-Mercaptophenyl)ether bis-(4-Isopropylphenyl)iodonium hexafluorophosphate bis-(4-Isopropylphenyl)iodonium chloride bis-(4-Hydroxyphenyl)acetic acid bis-(4-Hydroxybutyl) adipate bis-(4-Hydroxy-3-methylphenyl) sulfide bis-(4-Fluorophenyl)phenylphosphine oxide bis-(4-Fluorophenyl)iodonium chloride bis-(4-Fluorophenyl)chloromethane bis-(4-Fluorophenyl)acetic acid bis-(4-Fluorophenyl)(3-nitrophenyl)phosphine oxide bis-(4-Fluorophenyl) disulfide bis-(4-Ethylphenyl)acetylene bis-(4-Dimethylaminodithiobenzil)nickel bis-(4-Cyanophenyl)methanol bis-(4-Chlorophenyl)iodonium hexafluorophosphate bis-(4-Chlorophenyl)diselenide bis-(4-Chlorophenyl)acetic acid bis-(4-Chlorophenyl) sulfoxide bis-(4-Chlorooctafluorobutyl)ether bis-(4-Chlorobenzyl) azodicarboxylate bis-(4-Chlorobenzoyl) peroxide bis-(4-Chloro-phenyl)-pyridin-4-yl-methanol bis-(4-Chloro-3-nitrophenyl) disulfide
|
|
|
| bis-(4-tert-Butylphenyl)amine is offered by other companies |
JieJie Group Co., Ltd.
|
H&Z Industry Co.,Ltd
|
Amadis Chemical Company Limited
|
Xingrui Industry Co., Limited
|
Hangzhou Meite Industry Co., Ltd (Hangzhou Meite Chemical Co., Ltd)
Hangzhou Meite Industry Co., Ltd. is an international high-tech enterprise founded in 1998, specialized in R& D and manufacture on intermediates, medicines, agrochemical, dyestuff, flavor, fragrance, cosmetic, natural extracts series products. " ....
Send an inquiry on bis-(4-tert-Butylphenyl)amine to the supplier Hangzhou Meite Industry Co., Ltd (Hangzhou Meite Chemical Co., Ltd)
|
Hangzhou Lingrui Chemical Co., Ltd.
|
Ambeed, Inc.
|
BLD Pharmatech Ltd
|
AK Scientific, Inc.
|
Leap Chem Co., Ltd
|
|
|
|
|
|