|
|
|
Zouping Mingxing Chemical Co., Ltd.is a supplier of
|
 |
N-Methylolacrylamide |
|
|
This listing includes other chemicals and chemical products supplied by Zouping Mingxing Chemical Co., Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Zouping Mingxing Chemical Co., Ltd. |
Zouping Mingxing Chemical Co.,Ltd. established in 2002. It is one of subsidiary company of Shandong Liangzou Mining Group and covers the floor area of 48000 square meters, with the total investment of 350 million yuan. Now, the company has 56 professional technicians and long-term invites doctor and postdoctor to guide the works, mainly produces more than 100 kinds of pharmaceutical intermediate,pesticide intermediate,flavor & fragrance materials and textile auxiliary agent materials such as diallylamine, allylamine, triallylamine, dichloride, allylalcohol, allylacetate, allylcaproate, allylphenoxyacetate, allyl heptylate，Isopropyl Acetate, Acetyl acetone，allyl bromide，dibromomethane， 1,3-Propanediol, 1,3-Dichloropropane, 1-bromo-3-chloropropane, 1,3-Dibromopropane, 3-Chloro-1-propanol, 3-Bromo-1-propanol, N-methyldiallylamine, N-methylallylamine, etc.
So far, the company have 15 workshops and produce over 40000ts chemicals yearly.we have enough capacity to supply you and establish the steady cooperation relations. Moreover, we can help you produce the product that you need based on the technology cooperation and our equipments.
|
|
Zouping Mingxing Chemical Co., Ltd. also offers: N-Methyldidodecylamine N-Methylallylamine N-Methyl-n-propylamine N-Methyl-n-(n,N-dimethylaminoethyl)-aminoethanol N-Methyl-N,N-dioctadecyl-1-octadecanaminium chloride N-Methyl diallylamine hydrochloride N-Isopropylmethylamine N-Hydroxyphthalimide n-Hexadecyltrimethylammonium chloride N-Ethyl-3-trimethoxysilyl-2-methylpropanamine N-Ethyl-2-pyrrolidone N-Ethyl-2-methylallylamine N-Cocoalkyl-1,3-diaminopropane N-Chlorosuccinimide N-Bromosuccinimide N-Benzylacrylamide N-3-(Hydrogenated cocoamido) propyl dimethylamines N-(tert-Butyl)benzylamine N-(p-Chlorobenzoyl)-N-(p-methoxyphenyl)hydrazine N-(4-Sulfamoylphenyl)prop-2-enamide N-(3-Chloropropyl)morpholine N-(3-Chloropropyl)dibutylamine N-(3-Aminopropyl)imidazole N-(3-Aminophenyl) acetamide N-(3-(Trimethoxysilyl)propyl)butylamine N-(2-Methylphenyl)-2-(propylamino)propanamide N-(2-Hydroxyethyl)pyrrolidine N-(2-Hydroxyethyl)-4-aza-9-crown-3 N-(2-Aminoethyl)pyrrolidine N,O-bis-(Trimethylsilyl)acetamide (BSA) N,N-Dimethylolamidopropylamine N,N-Dimethylisopropylamine N,N-Dimethyldocosylamine N,N-Dimethylbehenamidopropylamine N,N-Dimethylacetamide N,N-Dimethyl acrylamide N,N-Diisopropylethylamine N,N-Diisopropyl methylamine N,N-Diethylethylenediamine N,N-Diethyl-p-phenylenediamine sulfate N,N-Dibutyl-5,6,12,13-tetrakis(4-(1,1-dimethylethyl)phenoxy)-3,4,9,10-perylenedicarboximide N,N'-Methylenebisacrylamide N,N'-Disuccinimidyl carbonate N,N'-bis-(2,6-Diisopropylphenyl)-3,4,9,10-perylenetetracarboxylic diimide MTHPA Mordant Brown 33 Mordant Blue 9 Mordant Black 9 Methyltriacetoxysilane Methylsulfone
|
|
|
| N-Methylolacrylamide is offered by other companies |
Fountain Biotechnology Co.,Ltd
|
Unilong Industry Co.,Ltd
|
OPQ Chemical Co., Ltd
|
Create Chemical Co., Ltd.
|
Aecochem Corp.
|
Sancai Industry Co.,Ltd.
|
Shandong Minglang Chemical Co., Ltd
|
Nantong Xindao Biotech Ltd
|
Simagchem Corporation
|
Lori Industry Co., Ltd
|
|
|
|
|
|