|
|
|
Shandong Lanhai Industry Co.,Ltd.is a supplier of
|
 |
N-Acetyl-L-cysteine |
|
|
This listing includes other chemicals and chemical products supplied by Shandong Lanhai Industry Co.,Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Shandong Lanhai Industry Co.,Ltd. |
Shandong Lanhai Industry Co., Ltd established in 2015. The headquartered located in the beautiful Spring city Jinan. The company's factory is located in Coal Chemical Industrial Park, Juye County, Heze City Shandong province.Lanhai Industry is a high-tech enterprise in Shandong Province. The company integrates science, industry and trade, specializing in the research, development, production and operation of fluorosilicone products, OLED intermediates and agricultural fertilizers. At the same time, it is also committed to the production, import and export business of cosmetic raw materials, pharmaceutical intermediates and other fine chemicals.
Shandong Lanhai Industry Co., Ltd. always adheres to the principle of "quality first, customer first, reputation first" to provide customers with high-quality products and services. We sincerely look forward to cooperating with you from all over the world and seek common development for the better world!
|
|
Shandong Lanhai Industry Co.,Ltd. also offers: N-Acetyl-L-carnosine N-Acetyl-D-glucosamine N-(Triethoxysilylpropyl)urea N-(N-Propyl)thiophosphoric triamide N-(n-Butyl) thiophosphoric triamide N-(Diphenylmethylene)glycine tert-butyl ester N-(Cyclohexylthio)phthalimide N-(Benzothiazol-2-ylthio)-N-cyclohexylbenzothiazole-2-sulfenamide N-(4-Oxocyclohexyl)acetamide N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzo[d]thiazol-2-amine N-(3-Triethoxysilylpropyl)ethylenediamine N-(3-Sulfopropyl)-3,3',5,5'-tetramethylbenzidine sodium salt N-(3-Aminopropyl)morpholine N-(3-Aminopropyl)-N-dodecylpropane-1,3-diamine N-(3-(Trimethoxysilyl)propyl)butylamine N-(2-Hydroxypropyl)morpholine N-(2-Hydroxyethyl)piperazine N-(2-Aminoethyl)piperazine N-(2-Aminoethyl)-3-aminopropyltrimethoxysilane N-(2-aminoethyl)-3-aminopropylmethyldimethoxysilane N-(2-Acetamido)iminodiacetic acid N-(2-Acetamido)-2-aminoethanesulfonic acid N,O-bis-(Trimethylsilyl)acetamide N,N-Dimethyltetradecylamine N,N-Dimethylpropionamide N,N-Dimethylolamidopropylamine N,N-Dimethyloctylamine N,N-Dimethyloctadecylamine N,N-Dimethylhexadecylamine N,N-Dimethylglycine N,N-Dimethylformamide N,N-Dimethyldodecylamine N,N-Dimethyldecylamine N,N-Dimethyldecanamide N,N-Dimethylcyclohexylamine N,N-Dimethylbenzylamine N,N-Dimethyl-N',N'-bis(2-hydroxypropyl)-1,3-propanediamine N,N-Dimethyl octanamide N,N-Dimethyl (octan/decan)amides N,N-Diisopropylbenzothiazole-2-sulfenamide N,N-Dihydroxyethyl-p-toluidine N,N-Diethylhydroxylamine N,N-Diethylformamide N,N-Diethylaniline N,N-Diethyl-p-phenylenediamine sulfate N,N-Diethyl-3-methylbenzamide N,N-Dicyclohexylbenzothiazole-2-sulfenamide N,N-di-(2-Hydroxypropyl) tallowamine N,N-bis-(2-Hydroxyethyl)glycine N,N,N-Trimethyl-1-adamantanaminium chloride
|
|
|
| N-Acetyl-L-cysteine is offered by other companies |
Hangzhou Verychem Science & Technology Co., Ltd.
|
Newstar Chem Enterprise Ltd.
|
Wuhan PharmChem Co., LTD.
|
OPQ Chemical Co., Ltd
|
X´ian Taicheng Chem Co., Ltd
|
Create Chemical Co., Ltd.
|
Xiamen Kinbester Co., Ltd.
|
Hangzhou Keying Chem Co., Ltd.
|
Aea.ltd
Aea.ltd provides unrivaled expertise and quality compliance by adhering to cGMP requirements. The manufacturing process at Aea.ltd adheres to cGMP standards. The management and technical teams are both professional and adhere to acceptable work" ....
Send an inquiry on N-Acetyl-L-cysteine to the supplier Aea.ltd
|
Nantong Xindao Biotech Ltd
|
|
|
|
|
|