|
|
|
Dayang Chem (Hangzhou) Co.,Ltd.is a supplier of
|
|
n-Propyl nitrite |
|
|
This listing includes other chemicals and chemical products supplied by Dayang Chem (Hangzhou) Co.,Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Information on Dayang Chem (Hangzhou) Co.,Ltd. |
Dayang Chem (Hangzhou) Co.,Ltd. is a comprehensive entity which specializes in development, production and trade of pharmaceutical, agrochemical and dyestuff intermediates as well as some special type reagents. We have an own factory and share enterprises. We act also as agent of many chemical factories and promote their products to the international market at very competitive price.
We take "Credi first, Clients supreme" as our aim. We expect to cooperate with more partners in the world by providing superior quality chemicals and best service.
|
Dayang Chem (Hangzhou) Co.,Ltd. also offers: n-Propyl methacrylate n-Propyl mercaptan n-Propyl lactate n-Propyl L-lactate n-Propyl isothiocyanate n-Propyl furoate n-Propyl formate N-Propyl cyclopropyl methyl amine N-Propyl cyclopropane carboxamide n-Propyl cyanoacetate (PCYA) n-Propyl chloroformate n-Propyl bromoacetate n-Propyl acetate N-Propyl 4-bromo-3-methoxybenzamide n-Propyl 3-mercaptopropionate n-Propyl 2-thienyl ketone n-Propyl 2-methylvalerate N-Propionylimidazole N-Propionyl-(2S)-bornane-10,2-sultam N-Propionyl-(2R)-bornane-10,2-sultam N-Propargylphthalimide N-Propargyl-lysine N-Pivaloylaniline N-Piperonylacetoacetamide N-Piperidinecarbonyl chloride N-Piperidin-3-ylmethyl-propionamide N-Piperidin-3-ylacetamide N-Phthalyl-L-alanine N-Phthalyl-D-norleucine N-Phthaloylglycine ethyl ester N-Phthaloyl-L-tryptophan N-Phthaloyl-L-phenylalanine N-Phthaloyl-L-glutamic acid N-Phosphonomethyl-glycine isopropyamin salt N-Phosphonomethyl iminodiacetic acid N-Phenylurethane N-Phenyltaurine N-Phenylpiperidone N-Phenylpiperidine-4-carboxamide hydrochloride N-Phenylpiperidine N-Phenylphenethylamine N-Phenyloleamide hydrochloride N-Phenylmorpholine N-Phenylmethoxycarbonyl-3-aminopropanal N-Phenylmethanesulfonamide N-Phenylmaleimide N-Phenylisonicotinamide N-Phenylindan-2-amine N-Phenyliminodiacetic acid N-Phenylhydroxylamine oxalate
|
|
|
n-Propyl nitrite is offered by other companies |
Xiamen Equation Chemical Co.,Ltd
|
Leap Chem Co., Ltd
|
Chemos GmbH & Co. KG
|
BuGuCh & Partners
|
|
|
|
|
|