|
|
|
Leap Chem Co., Ltdis a supplier of
|
 |
Propionamidine hydrochloride |
|
|
This listing includes other chemicals and chemical products supplied by Leap Chem Co., Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Leap Chem Co., Ltd |
LEAPChem, a specialized fine chemicals supplier for research, development and production.
LEAPChem provides nearly 5,000 rare and innovative chemical products to support the evolving needs of our customers in research & bulk manufacturing activities.
As a highly customer-oriented enterprise, we are committed to providing high-quality customer services and products to our global customers in a cost-effective and efficient manner.
Our client list includes many major pharmaceutical and science companies, universities, research institutions and chemical catalogue companies.
Methodology: Sound and Stable;Active and Innovative.
Attitude: Conscientious; Ingenious.
Goals: Customer’s Satisfaction
We regard client’s success as our success.
At LEAPChem we strive to be the preferred supplier for efficiency increasing and cost lowering in your Research&Production.
To achieve this strategic vision, we always push ourself to exceed our customer's requirement. By focusing 'Beyond Your Expectation' we continually expand our product line, enhance our systematic management and human resources.
Welcome to contact us and we look forward to becoming your preferred partner.
|
|
Leap Chem Co., Ltd also offers: Propionamide, N-[2-(4-pyridyl)ethyl]- Propionamide, N-salicylidene-(4ci) Propionamide, N-P-hydroxybenzylidene-(4ci) Propionamide, N-P-benzoquinonyl- Propionamide, N-methyl-N-(tetrahydropyran-2-yl)- Propionamide, N-m-hydroxybenzylidene-(4ci) Propionamide, N-isopentyl-N-nitroso-(5ci) Propionamide, N-(isopropylsulfonyl)-(5ci) Propionamide, N-(6-amino-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)-(5ci) Propionamide, N-(5-iodo-2-thiazolyl)-2-methyl- Propionamide, N-(5-chloro-2-thiazolyl)-2-methyl- Propionamide, N-(5-chloro-2-thiazolyl)-2,2-dimethyl- Propionamide, N-(4-oxo-2-thiazolin-2-yl)- Propionamide, N-(4-methyl-3-thienyl)-3-(propylamino)- Propionamide, N-(3,5-dimethyl-4-isoxazolyl)-2-(propylamino)- Propionamide, N-(2,5-dihydroxypentyl)-(5ci) Propionamide, N-(1,1-dimethylbutyl)-2-methyl- Propionamide, N-((N-nitrosobenzylamino)methyl)- Propionamide, alpha,-alpha-diacetamido- Propionamide, 2-methyl-2-propionamidothio- Propionamide, 2,3-diamino-N-(carbamoylmethyl)-, DL-(5ci) Propionamide Propionaldehyde-d2 Propionaldehyde-2,2,3,3,3-d5 Propionaldehyde, 3-(2-pyridylamino)-, dimethyl acetal Propionaldehyde thiosemicarbazone Propionaldehyde oxime Propionaldehyde dimethylacetal Propionaldehyde dimethyl hydrazone Propionaldehyde diethylacetal Propionaldehyde diallyl hydrazone Propionaldehyde cyanohydrin Propionaldehyde 2,4-dinitrophenylhydrazone-d3 Propionaldehyde 2,4-dinitrophenylhydrazone Propionaldehyde Propiomazinehydrochloride Propiomazine hydrogen maleate Propiomazine hydrochloride) Propiomazine Propiolic acid, (p-chlorophenyl)- Propiolic acid sodium salt Propiolic acid beta-naphthyl methyl ester Propiolic acid Propiolamide-13C3 Propiolamide, N-2-thiazolyl- Propiolamide Propioin Propio-d5-phenone Propio-2,2-d2-phenone Propinqualin
|
|
|
| Propionamidine hydrochloride is offered by other companies |
Shandong Minglang Chemical Co., Ltd
|
Skyrun Industrial Co., Ltd.
|
Dayang Chem (Hangzhou) Co.,Ltd.
|
AK Scientific, Inc.
|
Chemos GmbH & Co. KG
|
|
|
|
|
|