|
|
|
Shandong Lanhai Industry Co.,Ltd.is a supplier of
|
 |
N-Methyl-n-(n,N-dimethylaminoethyl)-aminoethanol |
|
|
This listing includes other chemicals and chemical products supplied by Shandong Lanhai Industry Co.,Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Shandong Lanhai Industry Co.,Ltd. |
Shandong Lanhai Industry Co., Ltd established in 2015. The headquartered located in the beautiful Spring city Jinan. The company's factory is located in Coal Chemical Industrial Park, Juye County, Heze City Shandong province.Lanhai Industry is a high-tech enterprise in Shandong Province. The company integrates science, industry and trade, specializing in the research, development, production and operation of fluorosilicone products, OLED intermediates and agricultural fertilizers. At the same time, it is also committed to the production, import and export business of cosmetic raw materials, pharmaceutical intermediates and other fine chemicals.
Shandong Lanhai Industry Co., Ltd. always adheres to the principle of "quality first, customer first, reputation first" to provide customers with high-quality products and services. We sincerely look forward to cooperating with you from all over the world and seek common development for the better world!
|
|
Shandong Lanhai Industry Co.,Ltd. also offers: N-Methyl-L-tyrosine N-Methyl-DL-alanine hydrochloride N-Methyl-1,2-benzenediamine dihydrochloride N-Hydroxysuccinimide n-Hexadecylamine n-Hexadecanethiol N-Formylmorpholine N-Ethylmethylamine N-Ethyldiisopropylamine N-Ethylcarbazole N-Ethyl-2-pyrrolidone n-Dodecyltrimethoxysilane n-Dodecyl-beta-D-maltoside n-Dodecyl methacrylate N-cyclohexyl-3-aminopropanesulfonic acid N-Cyclohexyl-2-pyrrolidinone N-Cyclohexyl-2-benzothiazolylsulfenamide N-Cocoalkyl-1,3-diaminopropane n-Capronaldehyde n-Butylboronic acid n-Butylamine n-Butyl vinyl ether n-Butyl stearate n-Butyl palmitate n-Butyl lithium n-Butyl laurate n-Butyl bromide N-Bromosuccinimide N-Boc-L-phenylalanine N-Boc-1,2,5,6-Tetrahydropyridine-4-boronic acid pinacol ester N-Benzoyl-DL-tyrosil-N',N'-dipropylamide N-Benzoyl-DL-tyrosil-di-n-propylamide N-Allyl-N,N-bis(trimethylsilyl)amine N-Acetylsulfanilyl chloride N-Acetylneuraminic acid N-Acetylmorpholine N-Acetylglucosamine N-Acetyl-L-cysteine N-Acetyl-L-carnosine N-Acetyl-D-glucosamine N-(Triethoxysilylpropyl)urea N-(N-Propyl)thiophosphoric triamide N-(n-Butyl) thiophosphoric triamide N-(Diphenylmethylene)glycine tert-butyl ester N-(Cyclohexylthio)phthalimide N-(Benzothiazol-2-ylthio)-N-cyclohexylbenzothiazole-2-sulfenamide N-(4-Oxocyclohexyl)acetamide N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzo[d]thiazol-2-amine N-(3-Triethoxysilylpropyl)ethylenediamine N-(3-Sulfopropyl)-3,3',5,5'-tetramethylbenzidine sodium salt
|
|
|
| N-Methyl-n-(n,N-dimethylaminoethyl)-aminoethanol is offered by other companies |
Tianjin Zhongxin Chemtech Co., Ltd.
|
Zouping Mingxing Chemical Co., Ltd.
|
OPQ Chemical Co., Ltd
|
Shandong Minglang Chemical Co., Ltd
|
Hangzhou Meite Industry Co., Ltd (Hangzhou Meite Chemical Co., Ltd)
Hangzhou Meite Industry Co., Ltd. is an international high-tech enterprise founded in 1998, specialized in R& D and manufacture on intermediates, medicines, agrochemical, dyestuff, flavor, fragrance, cosmetic, natural extracts series products. " ....
Send an inquiry on N-Methyl-n-(n,N-dimethylaminoethyl)-aminoethanol to the supplier Hangzhou Meite Industry Co., Ltd (Hangzhou Meite Chemical Co., Ltd)
|
Skyrun Industrial Co., Ltd.
|
Chemlyte Solutions
|
Leap Chem Co., Ltd
|
|
|
|
|
|