|
|
|
Leap Chem Co., Ltdis a supplier of
|
 |
Ethyltrichlorosilane |
|
|
This listing includes other chemicals and chemical products supplied by Leap Chem Co., Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Leap Chem Co., Ltd |
LEAPChem, a specialized fine chemicals supplier for research, development and production.
LEAPChem provides nearly 5,000 rare and innovative chemical products to support the evolving needs of our customers in research & bulk manufacturing activities.
As a highly customer-oriented enterprise, we are committed to providing high-quality customer services and products to our global customers in a cost-effective and efficient manner.
Our client list includes many major pharmaceutical and science companies, universities, research institutions and chemical catalogue companies.
Methodology: Sound and Stable;Active and Innovative.
Attitude: Conscientious; Ingenious.
Goals: Customer’s Satisfaction
We regard client’s success as our success.
At LEAPChem we strive to be the preferred supplier for efficiency increasing and cost lowering in your Research&Production.
To achieve this strategic vision, we always push ourself to exceed our customer's requirement. By focusing 'Beyond Your Expectation' we continually expand our product line, enhance our systematic management and human resources.
Welcome to contact us and we look forward to becoming your preferred partner.
|
|
Leap Chem Co., Ltd also offers: Ethyltributyltin Ethyltributylphosphonium ethyl sulfate Ethyltributylphosphonium bromide Ethyltri-n-propylammonium iodide Ethyltri(octadecyl)ammonium ethyl sulfate Ethyltrans-4-bromocinnamate Ethylthiophosphonic acid O-isopropyl O-(2-chloro-4-nitrophenyl) ester Ethylthiophosphonic acid O-ethyl O-[4-(methylsulfinyl)phenyl] ester Ethylthiophosphonic acid O-ethyl O-(2,4-dichlorophenyl) ester Ethylthiophosphonic acid O-(2,5-dichloro-4-iodophenyl)o-ethyl ester Ethylthiophene-2-carboximidoatehydrochloride Ethylthioethyl methacrylate Ethylthio, 2-(acetylamino)-2-carboxy-1,1-dimethyl- Ethyltetrahydrofurfurylether Ethylsulfuric acid sodium salt Ethylsulfonylacetonitrile Ethylsulfinylmethylsulfanyl-dipropan-2-yloxy-sulfanylidene-phosphorane Ethylsulfanylmethanethioamide Ethylsulfanylformaldehyde Ethylsulfanyl-(5-nitro-2-furyl)methanone Ethylsulfanyl-(4-methylpiperazin-1-yl)methanethione hydrochloride Ethylsulfanyl-(4-ethylsulfonylphenyl)methanone Ethylsulfamoyl chloride Ethylsulfamic acid Ethylsuccinylazolamide Ethylsuccinyl chloride Ethylsuccinonitrile Ethylsuccinaldehyde Ethylstyrene Ethylsilsesquioxane Ethylsilane Ethylsarin Ethylpyrocatechol Ethylphosphorodichloridate Ethylphosphonothioic acid O-isopropyl O-(p-nitrophenyl) ester Ethylphosphonothioic acid O-ethyl S-methyl ester Ethylphosphonothioic acid O-ethyl O-(3-methyl-4-nitrophenyl) ester Ethylphosphonothioic acid O-(2-chloro-4-nitrophenyl)o-ethyl ester Ethylphosphonothioic acid O-(2,5-dichlorophenyl)o-ethyl ester Ethylphosphonothiodichloride Ethylphosphonodithioic acid S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]o-propyl ester Ethylphosphonodithioic acid S-(4-chloro-3-methylphenyl)o-ethyl ester Ethylphosphonodithioic acid O-methyl S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] ester Ethylphosphonodithioic acid O-isopropyl S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] ester Ethylphosphonodithioic acid O-ethyl S-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl] ester Ethylphosphonodithioic acid O-ethyl S-(o-tolyl) ester Ethylphosphonodithioic acid Ethylphosphonic acid, dipropyl ester Ethylphosphonic acid, dipentyl ester Ethylphosphonic acid p-nitrophenyl(methyl) ester
|
|
|
| Ethyltrichlorosilane is offered by other companies |
Hangzhou Keying Chem Co., Ltd.
|
Simagchem Corporation
|
Zehao Industry Co., Ltd.
|
Autech Industry Co.,Limited
|
Dayang Chem (Hangzhou) Co.,Ltd.
|
Chemlyte Solutions
|
Chemos GmbH & Co. KG
|
BuGuCh & Partners
|
|
|
|
|
|