|
|
|
Leap Chem Co., Ltdis a supplier of
|
 |
Fmoc-O-Trityl-L-serine |
|
|
This listing includes other chemicals and chemical products supplied by Leap Chem Co., Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Leap Chem Co., Ltd |
LEAPChem, a specialized fine chemicals supplier for research, development and production.
LEAPChem provides nearly 5,000 rare and innovative chemical products to support the evolving needs of our customers in research & bulk manufacturing activities.
As a highly customer-oriented enterprise, we are committed to providing high-quality customer services and products to our global customers in a cost-effective and efficient manner.
Our client list includes many major pharmaceutical and science companies, universities, research institutions and chemical catalogue companies.
Methodology: Sound and Stable;Active and Innovative.
Attitude: Conscientious; Ingenious.
Goals: Customer’s Satisfaction
We regard client’s success as our success.
At LEAPChem we strive to be the preferred supplier for efficiency increasing and cost lowering in your Research&Production.
To achieve this strategic vision, we always push ourself to exceed our customer's requirement. By focusing 'Beyond Your Expectation' we continually expand our product line, enhance our systematic management and human resources.
Welcome to contact us and we look forward to becoming your preferred partner.
|
|
Leap Chem Co., Ltd also offers: Fmoc-O-tert-Butyl-L-tyrosinol Fmoc-O-tert-Butyl-L-tyrosine Fmoc-O-tert-Butyl-L-threoninen-carboxyanhydride Fmoc-O-tert-Butyl-L-threonine Fmoc-O-tert-Butyl-L-serinen-carboxyanhydride Fmoc-O-tert-Butyl-L-serine3,4-dihydro-4-oxo-1,2,3-benzotriazin-3-ylester Fmoc-O-tert-Butyl-L-serine Fmoc-O-tert-Butyl-L-β-homohydroxyproline Fmoc-O-tert-Butyl-D-tyrosine Fmoc-O-tert-Butyl-D-threonine Fmoc-O-tert-Butyl-D-serine Fmoc-O-Sulfo-L-tyrosine barium salt hydrate Fmoc-O-Phospho-L-tyrosine Fmoc-O-Phospho-L-serine Fmoc-O-methyl-DL-tyrosine Fmoc-O-Methyl-D-ser Fmoc-O-ethyl-L-tyrosine Fmoc-O-ethyl-D-tyrosine Fmoc-O-Butyl-L-tyrosine N-hydroxysuccinimide ester Fmoc-O-Benzyl-L-tyrosyl chloride Fmoc-O-Benzyl-L-tyrosine Fmoc-O-Benzyl-L-threonine Fmoc-O-Benzyl-L-seryl chloride Fmoc-O-Benzyl-L-serine Fmoc-O-Benzyl-L-4-hydroxyproline Fmoc-O-(Benzylphospho)-L-threonine Fmoc-O-(Benzylphospho)-L-serine Fmoc-Nva-OH Fmoc-norArg(Pbf)-OH Fmoc-norArg(Me,pbf)-OH Fmoc-Nomega-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-L-homoarginine Fmoc-Nle-OSu Fmoc-Nle-OPfp Fmoc-Nle-OH Fmoc-Nle-Nle-OH Fmoc-Nip-OH Fmoc-Nip-OH Fmoc-nh-peg7-ch2ch2cooh Fmoc-NH-PEG6-CH2COOH Fmoc-Nh-peg12-ch2cooh Fmoc-NH-PEG12-CH2CH2COOH Fmoc-Nh-ethyl-ss-propionic acid Fmoc-nh-8(ethylene glycol)-acetic acid Fmoc-nh-5(ethylene glycol)-acetic acid Fmoc-NH-(PEG)9-CH2CH2COOH Fmoc-Nh-(peg)2-cooh Fmoc-Nh(ch2)4nh2 hydrochloride Fmoc-Nh(ch2)3nh2 hydrochloride Fmoc-Ngamma-trityl-L-beta-homoglutamine Fmoc-Ndelta-methyltrityl-L-glutamine
|
|
|
| Fmoc-O-Trityl-L-serine is offered by other companies |
Simagchem Corporation
|
Xiamen Hisunny Chemical Co., Ltd.
|
Autech Industry Co.,Limited
|
Xiamen Equation Chemical Co.,Ltd
|
AK Scientific, Inc.
|
|
|
|
|
|