|
|
|
BuGuCh & Partnersis a supplier of
|
 |
p-Benzoquinone |
|
|
This listing includes other chemicals and chemical products supplied by BuGuCh & Partners.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on BuGuCh & Partners |
We, BuGuCh & Partners, are an international acting and innovative company, leading in developing and manufacturing.
We operates major facilities in North America, Europe and the Pacific Rim, as well as facilities in China, Japan and Saudi Arabia operated through joint ventures.
We maintain independently or are partners of some production sites in Europe, Asia and South America. Our global network is a strength.
Our products range from natural gas, oil and basic chemical products through innovative intermediates to specialties, high value-added chemicals, crop protection products and pharmaceuticals.
|
|
BuGuCh & Partners also offers: p-Benzenediacrylanilide, 4′,4′′-di-2-imidazolin-2-yl-, dihydrochloride p-Anisyldiphenylphosphine p-Anisyl-p-nitro blue tetrazolium chloride (ANBT) p-Anisyl-p-benzoquinone p-Anisyl hexyl ketone p-Anisyl alcohol p-Anisidine-2,5-disulfonic acid p-Anisidine hydrochloride p-Anisidine p-Aniside-o-sulfonic acid p-Anisaldehyde dimethyl acetal p-Anisaldehyde p-Anilinobenzenesulfonic acid p-Anilinobenzenediazonium sulfate (2:1) p-Aminophenyldichloroarsine hydrochloride p-Aminophenyl arsenoxide 2-hydrate p-Aminophenol p-Aminooxanilic acid p-Aminobenzonitrile p-Aminobenzenesulfonic acid p-Aminoazobenzene hydrochloride p-Aminoanisole p-Aminoacetanilide p-Amino-L-phenylalanine hydrochloride hemihydrate p-Amino-L-phenylalanine p-Amino-DL-phenylalanine 1-hydrate p-Amino dimethylaniline sulfate p-Acetylanisole p-Acetylaminobenzene sulfonyl chloride p-Acetoxy styrene p-Acetanisole p-Acetaminophenol p-Acetamidophenyl beta-D-glucuronide p-(Triphenylmethyl)phenol p-(tert-Butyl)[(2-hydroxy-1-naphthyl)methylene]benzohydrazide p-(tert-Butyl)phenethyldimethylchlorosilane p-(tert-Butyl)benzyl acetate p-(Propoxycarbonyl)phenyl 3-nitro-p-toluate p-(Phenylazo)benzyl chloroformate p-(Pentyloxy)toluene p-(Pentadecafluoroheptyl)benzenesulfonyl chloride p-(p-Anilinoanilino)phenol p-(n-Dodecyl)benzoic acid p-(Methylthio)benzaldehyde p-(Methyleneamino)-N-(4-methyl-2-pyrimidyl)benzenesulfonamide p-(Methoxymethyl)anisole p-(Isopentyl)benzaldehyde p-(Hexyloxy)cinnamic acid p-(Ethoxymethyl)anisole p-(Epoxyethyl)styrene
|
|
|
| p-Benzoquinone is offered by other companies |
INNOCHEM
INNOCHEM is an ISO 9001 certified company specialized in the worldwide marketing of chemical specialties for a wide range of industries. From our offices in Belgium, France, Germany, the Netherlands and USA and through our network of contacts in the" ....
Send an inquiry on p-Benzoquinone to the supplier INNOCHEM
|
OPQ Chemical Co., Ltd
|
Sancai Industry Co.,Ltd.
|
Simagchem Corporation
|
Xiamen Equation Chemical Co.,Ltd
|
Leap Chem Co., Ltd
|
|
|
|
|
|