|
|
|
Dayang Chem (Hangzhou) Co.,Ltd.is a supplier of
|
_Co_Ltd_1_575.jpg "Dayang Chem (Hangzhou) Co.,Ltd.") |
p-Aminobenzoyl benzamide |
|
|
This listing includes other chemicals and chemical products supplied by Dayang Chem (Hangzhou) Co.,Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Dayang Chem (Hangzhou) Co.,Ltd. |
Dayang Chem (Hangzhou) Co.,Ltd. is a comprehensive entity which specializes in development, production and trade of pharmaceutical, agrochemical and dyestuff intermediates as well as some special type reagents. We have an own factory and share enterprises. We act also as agent of many chemical factories and promote their products to the international market at very competitive price.
We take "Credi first, Clients supreme" as our aim. We expect to cooperate with more partners in the world by providing superior quality chemicals and best service.
|
|
Dayang Chem (Hangzhou) Co.,Ltd. also offers: p-Aminobenzoic acid monoglyceryl ester p-Aminobenzoic acid magnesium salt p-Aminoazobenzene-4'-sulfonic acid p-Aminoazobenzene hydrochloride p-Aminoacetanilide p-Amino-L-phenylalanine hydrochloride hemihydrate p-Amino-L-phenylalanine p-Allyltoluene p-Acetoxycinnamic acid p-Acetotoluidine p-Acetoacetanisidide p-(tert-Butyldimethylsiloxy)styrene p-(tert-Butyl)phenethyldimethylchlorosilane p-(Phenylazo)benzyl chloroformate p-(n-Dodecyl)benzoic acid p-(Isopentyl)benzaldehyde p-(Hexyloxy)cinnamic acid p-(Dimethylamino)phenol hydrochloride p-(Dimethoxymethyl)toluene p-(beta-Bromoethyl)acetophenone p-(Benzylsulfonamido)benzoic acid p-(4,5-Dihydro-3-methyl-1H-pyrazol-1-yl)benzenesulfonic acid p-(3-Hydrazino-3-oxopropoxy)benzohydrazide P-(3-Bromopropyl)phosphonic acid diethyl ester p-(2-N-Aminoethyl)benzene sulfonamide hydrochloride p-(2-Chloro)ethyl anisol P-(2,5-dichlorophenyl)phosphonic acid p-(1-Methyloctyl)phenol p-(1-Adamantyl)toluene p-(1,1-Dimethylheptyl)phenol p-((p-Methoxyphenyl)azo)phenol P,p'-[p-phenylenebis(azo)]bisphenol p,p'-Oxy-bis-(benzene sulfonyl hydrazide) P(3HB-co-4HB) Ozagrel sodium Ozagrel methyl ester Ozagrel hydrochloride Oxytocin acetate Oxytocin (free acid) Oxythiamine hydrochloride Oxytetracycline hydrochloride Oxytetracycline 2-hydrate Oxysophocarpine Oxyresveratrol Oxyphenyl butazone Oxyphenonium bromide Oxyphenisatin Oxyphencyclimine hydrochloride Oxyphenbutazone hydrate Oxypeucedanin
|
|
|
| p-Aminobenzoyl benzamide is offered by other companies |
Simagchem Corporation
|
Xiamen Hisunny Chemical Co., Ltd.
|
Hangzhou Meite Industry Co., Ltd (Hangzhou Meite Chemical Co., Ltd)
Hangzhou Meite Industry Co., Ltd. is an international high-tech enterprise founded in 1998, specialized in R& D and manufacture on intermediates, medicines, agrochemical, dyestuff, flavor, fragrance, cosmetic, natural extracts series products. " ....
Send an inquiry on p-Aminobenzoyl benzamide to the supplier Hangzhou Meite Industry Co., Ltd (Hangzhou Meite Chemical Co., Ltd)
|
Chemlyte Solutions
|
Leap Chem Co., Ltd
|
Chemos GmbH & Co. KG
|
|
|
|
|
|