|
|
|
Leap Chem Co., Ltdis a supplier of
|
 |
Boc-Arg(Pbf)-OH |
|
|
This listing includes other chemicals and chemical products supplied by Leap Chem Co., Ltd.
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Leap Chem Co., Ltd |
LEAPChem, a specialized fine chemicals supplier for research, development and production.
LEAPChem provides nearly 5,000 rare and innovative chemical products to support the evolving needs of our customers in research & bulk manufacturing activities.
As a highly customer-oriented enterprise, we are committed to providing high-quality customer services and products to our global customers in a cost-effective and efficient manner.
Our client list includes many major pharmaceutical and science companies, universities, research institutions and chemical catalogue companies.
Methodology: Sound and Stable;Active and Innovative.
Attitude: Conscientious; Ingenious.
Goals: Customer’s Satisfaction
We regard client’s success as our success.
At LEAPChem we strive to be the preferred supplier for efficiency increasing and cost lowering in your Research&Production.
To achieve this strategic vision, we always push ourself to exceed our customer's requirement. By focusing 'Beyond Your Expectation' we continually expand our product line, enhance our systematic management and human resources.
Welcome to contact us and we look forward to becoming your preferred partner.
|
|
Leap Chem Co., Ltd also offers: Boc-Arg(Mts)-OH.CHA Boc-Arg(Mts)-OH Boc-Arg(Mts)-OH Boc-Arg(Mbs)-OH Boc-Arg(Boc)2-OH Boc-Aoa-nh-(ch2)2-S-s-pyr Boc-Aminooxy-peg4-propargyl Boc-Aminooxy-peg3-thiol Boc-Aminooxy-peg3-propargyl Boc-Aminooxy-peg3-bromide Boc-Aminooxy-peg3-acid Boc-Aminooxy-peg2-propargyl Boc-Aminooxy-peg2-azide Boc-Aminooxy-peg2-amine Boc-Aminooxy-peg1-propargyl Boc-Aminomalonic acid Boc-Aminoisobutyric acid nca Boc-Amino-(3-methoxyphenyl)acetic acid Boc-Amino-(3-bromophenyl)acetic acid Boc-AMCP-OH Boc-alpha-methylalanine Boc-alpha-methyl-L-phenylalanine Boc-alpha-Methyl-L-aspartic acid Boc-alpha-Methyl-DL-tryptophan Boc-alpha-Methyl-DL-methionine Boc-alpha-Methyl-DL-leucine Boc-alpha-Methyl-DL-glutamic acid Boc-alpha-methyl-D-phenylalanine Boc-alpha-Methyl-D-aspartic acid Boc-alpha-methyl-3-methoxy-DL-phenylalanine Boc-alpha-Me-DL-Val-OH Boc-alpha-Me-DL-Pro-OH Boc-alpha-Et-D-Ala-OH Boc-Alpha-aminomethyl-4-hydroxybenzyl alcohol Boc-alpha-Allyl-L-alanine Boc-alpha-allyl-DL-Pro-OH Boc-alpha-(1-naphthylmethyl)-DL-Pro-OH Boc-allo-Thr-OH.DCHA Boc-allo-Ile-OH Boc-Albizziin Boc-Alanine pentafluorophenyl ester Boc-Ala-Pro-OH Boc-Ala-Pro-Nva-4-chloro-SBzl Boc-Ala-OtBu Boc-Ala-ONp Boc-Ala-OBzl Boc-Ala-NH2 Boc-Ala-N(OCH3)CH3 Boc-Ala-Met-OH Boc-Ala-Ile-OH
|
|
|
| Boc-Arg(Pbf)-OH is offered by other companies |
Xiamen Hisunny Chemical Co., Ltd.
|
Finetech Industry Limited
|
Ambeed, Inc.
|
AK Scientific, Inc.
|
Chemos GmbH & Co. KG
|
|
|
|
|
|