|
|
|
Dayang Chem (Hangzhou) Co.,Ltd.is a supplier of
|
_Co_Ltd_1_575.jpg "Dayang Chem (Hangzhou) Co.,Ltd.") |
p-Bromophenoxyacetic acid |
|
|
This listing includes other chemicals and chemical products supplied by Dayang Chem (Hangzhou) Co.,Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Dayang Chem (Hangzhou) Co.,Ltd. |
Dayang Chem (Hangzhou) Co.,Ltd. is a comprehensive entity which specializes in development, production and trade of pharmaceutical, agrochemical and dyestuff intermediates as well as some special type reagents. We have an own factory and share enterprises. We act also as agent of many chemical factories and promote their products to the international market at very competitive price.
We take "Credi first, Clients supreme" as our aim. We expect to cooperate with more partners in the world by providing superior quality chemicals and best service.
|
|
Dayang Chem (Hangzhou) Co.,Ltd. also offers: p-Bromooctanophenone p-Bromonitrobenzene p-Bromo-N-cyclohexyl-N-methylaniline p-bis[2-(5-p-Biphenyloxazolyl)]benzene p-Benzoquinone dioxime p-Azoxyanisole p-Azidoacetophenone p-Arsanilic acid p-Anisyldiphenylphosphine p-Anisyl-p-nitro blue tetrazolium chloride (ANBT) p-Anisyl-p-benzoquinone p-Anisyl hexyl ketone p-Anisoyl chloride p-Anisidine hydrochloride p-Anisidine p-Anisic anhydride p-Anisic acid ethyl ester p-Anisaldehyde dimethyl acetal p-Anisaldehyde p-Anilinobenzenesulfonic acid p-Anilinobenzenediazonium sulfate (2:1) p-Aminosalicylic acid magnesium salt p-Aminophenyl-beta-D-cellobioside p-Aminoethylbenzaldehyde hydrochloride p-Aminocyclohexylcarboxylic acid p-Aminobenzoyl benzamide p-Aminobenzoic acid monoglyceryl ester p-Aminobenzoic acid magnesium salt p-Aminoazobenzene-4'-sulfonic acid p-Aminoazobenzene hydrochloride p-Aminoacetanilide p-Amino-L-phenylalanine hydrochloride hemihydrate p-Amino-L-phenylalanine p-Allyltoluene p-Acetoxycinnamic acid p-Acetotoluidine p-Acetoacetanisidide p-(tert-Butyldimethylsiloxy)styrene p-(tert-Butyl)phenethyldimethylchlorosilane p-(Phenylazo)benzyl chloroformate p-(n-Dodecyl)benzoic acid p-(Isopentyl)benzaldehyde p-(Hexyloxy)cinnamic acid p-(Dimethylamino)phenol hydrochloride p-(Dimethoxymethyl)toluene p-(beta-Bromoethyl)acetophenone p-(Benzylsulfonamido)benzoic acid p-(4,5-Dihydro-3-methyl-1H-pyrazol-1-yl)benzenesulfonic acid p-(3-Hydrazino-3-oxopropoxy)benzohydrazide P-(3-Bromopropyl)phosphonic acid diethyl ester
|
|
|
| p-Bromophenoxyacetic acid is offered by other companies |
Zehao Industry Co., Ltd.
|
Hangzhou Lingrui Chemical Co., Ltd.
|
Chemlyte Solutions
|
Leap Chem Co., Ltd
|
|
|
|
|
|